* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ERYTHROSKYRINE |
| CAS: | 4987-27-3 |
| English Synonyms: | ERYTHROSKYRINE |
| MDL Number.: | MFCD01687150 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC1CC2C(O1)C(C(O2)/C=C/C=C/C=C/C=C/C=C/C(=O)C3=C(C(N(C3=O)C)C(C)C)O)O |
| InChi: | InChI=1S/C26H33NO6/c1-16(2)22-24(30)21(26(31)27(22)4)18(28)13-11-9-7-5-6-8-10-12-14-19-23(29)25-20(33-19)15-17(3)32-25/h5-14,16-17,19-20,22-23,25,29-30H,15H2,1-4H3/b6-5+,9-7+,10-8+,13-11+,14-12+ |
| InChiKey: | InChIKey=UIINQEVAMDOHAP-IKBQUROISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.