* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ELORINE SULFATE |
| English Synonyms: | ELORINE SULFATE |
| MDL Number.: | MFCD01687638 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[N+]1(CCCC1)CCC(c2ccccc2)(C3CCCCC3)O.COS(=O)(=O)[O-] |
| InChi: | InChI=1S/C20H32NO.CH4O4S/c1-21(15-8-9-16-21)17-14-20(22,18-10-4-2-5-11-18)19-12-6-3-7-13-19;1-5-6(2,3)4/h2,4-5,10-11,19,22H,3,6-9,12-17H2,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChiKey: | InChIKey=SOWZZZARRXSFKR-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.