* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BROPIRIMINE |
| CAS: | 56741-95-8 |
| English Synonyms: | 2-AMINO-5-BROMO-6-PHENYL-4(3H)-PYRIMIDINONE ; BROPIRIMINE ; U 54461S |
| MDL Number.: | MFCD01689128 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)c2c(c(=O)nc([nH]2)N)Br |
| InChi: | InChI=1S/C10H8BrN3O/c11-7-8(6-4-2-1-3-5-6)13-10(12)14-9(7)15/h1-5H,(H3,12,13,14,15) |
| InChiKey: | InChIKey=CIUUIPMOFZIWIZ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.