* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERAMID |
| CAS: | 8015-18-7 |
| English Synonyms: | VERAMID |
| MDL Number.: | MFCD01689196 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCC1(C(=O)NC(=O)NC1=O)CC.Cc1c(c(=O)n(n1C)c2ccccc2)N(C)C |
| InChi: | InChI=1S/C13H17N3O.C8H12N2O3/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11;1-3-8(4-2)5(11)9-7(13)10-6(8)12/h5-9H,1-4H3;3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChiKey: | InChIKey=OUTUZEBQXNEVGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.