* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H,11H-PYRAZINO(2,1-C)PYRROLO(1,2-A)(1,4)BENZODIAZEPIN-11-ONE, 12,13,1 4,14A-TETRAHYDRO-13-ACETYL- |
CAS: | 144109-17-1 |
English Synonyms: | 9H,11H-PYRAZINO(2,1-C)PYRROLO(1,2-A)(1,4)BENZODIAZEPIN-11-ONE, 12,13,1 4,14A-TETRAHYDRO-13-ACETYL- |
MDL Number.: | MFCD01693835 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(=O)N1CC2c3cccn3-c4ccccc4CN2C(=O)C1 |
InChi: | InChI=1S/C17H17N3O2/c1-12(21)18-10-16-15-7-4-8-19(15)14-6-3-2-5-13(14)9-20(16)17(22)11-18/h2-8,16H,9-11H2,1H3 |
InChiKey: | InChIKey=SAOTZOXZIFJAOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.