* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-PURIN-6-AMINE, 9-(2,3,5,6-TETRAMETHYLBENZOYL)- |
CAS: | 36855-54-6 |
English Synonyms: | 9-(2,3,5,6-TETRAMETHYLBENZOYL)-9H-PURIN-6-AMINE ; 9H-PURIN-6-AMINE, 9-(2,3,5,6-TETRAMETHYLBENZOYL)- |
MDL Number.: | MFCD01694452 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cc(c(c(c1C)C(=O)n2cnc3c2ncnc3N)C)C |
InChi: | InChI=1S/C16H17N5O/c1-8-5-9(2)11(4)12(10(8)3)16(22)21-7-20-13-14(17)18-6-19-15(13)21/h5-7H,1-4H3,(H2,17,18,19) |
InChiKey: | InChIKey=XJHVHCIMHGZYCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.