* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IPD |
| CAS: | 3458-22-8 |
| English Synonyms: | IPD |
| MDL Number.: | MFCD01696892 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CS(=O)(=O)OCCCNCCCOS(=O)(=O)C.Cl |
| InChi: | InChI=1S/C8H19NO6S2.ClH/c1-16(10,11)14-7-3-5-9-6-4-8-15-17(2,12)13;/h9H,3-8H2,1-2H3;1H |
| InChiKey: | InChIKey=YWCASUPWYFFUHE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.