* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FALIRYTMIN |
CAS: | 58774-82-6 |
English Synonyms: | FALIRYTMIN |
MDL Number.: | MFCD01696927 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CCOc1ccccc1OCC(CNCCNCC(COc2ccccc2OCC)O)O |
InChi: | InChI=1S/C24H36N2O6/c1-3-29-21-9-5-7-11-23(21)31-17-19(27)15-25-13-14-26-16-20(28)18-32-24-12-8-6-10-22(24)30-4-2/h5-12,19-20,25-28H,3-4,13-18H2,1-2H3 |
InChiKey: | InChIKey=LQRWQSNUPPEVHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.