* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENITROPANE |
CAS: | 65934-94-3 |
English Synonyms: | FENITROPANE |
MDL Number.: | MFCD01697792 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CC(=O)OC[C@@H]([C@H](c1ccccc1)OC(=O)C)[N+](=O)[O-] |
InChi: | InChI=1S/C13H15NO6/c1-9(15)19-8-12(14(17)18)13(20-10(2)16)11-6-4-3-5-7-11/h3-7,12-13H,8H2,1-2H3/t12-,13-/m0/s1 |
InChiKey: | InChIKey=AYBALPYBYZFKDS-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.