* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FECATETRAENE-10 |
CAS: | 127128-50-1 |
English Synonyms: | FECATETRAENE-10 |
MDL Number.: | MFCD01698072 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC/C=C/C=C/C=C/C=C/OCC(CO)O |
InChi: | InChI=1S/C13H20O3/c1-2-3-4-5-6-7-8-9-10-16-12-13(15)11-14/h3-10,13-15H,2,11-12H2,1H3/b4-3+,6-5+,8-7+,10-9+ |
InChiKey: | InChIKey=BYZCTZPRJUIUHG-BYFNFPHLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.