* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1898861 |
| English Synonyms: | OTAVA-BB 1898861 |
| MDL Number.: | MFCD01698745 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCOC1=C(OC)C=CC=C1CNC(=O)CCCl |
| InChi: | InChI=1S/C15H22ClNO3/c1-3-4-10-20-15-12(6-5-7-13(15)19-2)11-17-14(18)8-9-16/h5-7H,3-4,8-11H2,1-2H3,(H,17,18) |
| InChiKey: | InChIKey=KNBYLZNDMJGNPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.