* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SAFRACIN A |
| CAS: | 87578-98-1 |
| English Synonyms: | SAFRACIN A |
| MDL Number.: | MFCD01698758 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | Cc1cc2c(c(c1OC)O)[C@H]3[C@H]4CC5=C([C@H](N4C[C@@H](C2)N3C)CNC(=O)[C@H](C)N)C(=O)C(=C(C5=O)C)OC |
| InChi: | InChI=1S/C28H36N4O6/c1-12-7-15-8-16-11-32-18(22(31(16)4)20(15)24(34)26(12)37-5)9-17-21(19(32)10-30-28(36)14(3)29)25(35)27(38-6)13(2)23(17)33/h7,14,16,18-19,22,34H,8-11,29H2,1-6H3,(H,30,36)/t14-,16+,18+,19+,22+/m0/s1 |
| InChiKey: | InChIKey=AZDDAJXLYMVMAW-OMNPOQOLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.