* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ORACONAL |
| CAS: | 8064-66-2 |
| English Synonyms: | ORACONAL |
| MDL Number.: | MFCD01698972 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC1=C[C@@H]2[C@H](CC[C@]3([C@H]2CC[C@@]3(C(=O)C)OC(=O)C)C)[C@@]4(C1=CC(=O)CC4)C.C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CC[C@@]2(C#C)O)O |
| InChi: | InChI=1S/C24H32O4.C20H24O2/c1-14-12-18-19(22(4)9-6-17(27)13-21(14)22)7-10-23(5)20(18)8-11-24(23,15(2)25)28-16(3)26;1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h12-13,18-20H,6-11H2,1-5H3;1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3/t18-,19+,20+,22-,23+,24+;16-,17-,18+,19+,20-/m11/s1 |
| InChiKey: | InChIKey=NIXVMBBZNVOBHS-OTTBCCRRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.