* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SPIROPLATIN |
| CAS: | 74790-08-2 |
| English Synonyms: | SPIROPLATIN |
| MDL Number.: | MFCD01699129 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C1CCC(CC1)(CN)CN.[O-]S(=O)(=O)[O-].[Pt+2] |
| InChi: | InChI=1S/C8H18N2.H2O4S.Pt/c9-6-8(7-10)4-2-1-3-5-8;1-5(2,3)4;/h1-7,9-10H2;(H2,1,2,3,4);/q;;+2/p-2 |
| InChiKey: | InChIKey=XASGSSXPZXRXFL-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.