* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EURAZYL |
| CAS: | 53198-87-1 |
| English Synonyms: | EURAZYL |
| MDL Number.: | MFCD01701301 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCC(C)C(CCN1CCCCC1)(C#N)c2ccccc2.Cl |
| InChi: | InChI=1S/C19H28N2.ClH/c1-3-17(2)19(16-20,18-10-6-4-7-11-18)12-15-21-13-8-5-9-14-21;/h4,6-7,10-11,17H,3,5,8-9,12-15H2,1-2H3;1H |
| InChiKey: | InChIKey=CSYYQOYMUKFICA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.