* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLUPROPADINE |
CAS: | 81613-59-4 |
English Synonyms: | FLUPROPADINE |
MDL Number.: | MFCD01701443 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(C)(C)C1CCN(CC1)CC#Cc2cc(cc(c2)C(F)(F)F)C(F)(F)F |
InChi: | InChI=1S/C20H23F6N/c1-18(2,3)15-6-9-27(10-7-15)8-4-5-14-11-16(19(21,22)23)13-17(12-14)20(24,25)26/h11-13,15H,6-10H2,1-3H3 |
InChiKey: | InChIKey=KCVJZJNNTBOLKH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.