* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VUFB-12430 |
CAS: | 77795-68-7 |
English Synonyms: | VUFB-12430 |
MDL Number.: | MFCD01703499 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(ccc1CN2CCN(CC2)C3Cc4ccc(cc4Sc5c3cc(cc5)Cl)F)F |
InChi: | InChI=1S/C25H23ClF2N2S/c26-19-4-8-24-22(14-19)23(13-18-3-7-21(28)15-25(18)31-24)30-11-9-29(10-12-30)16-17-1-5-20(27)6-2-17/h1-8,14-15,23H,9-13,16H2 |
InChiKey: | InChIKey=SEPNTYFXXLNJOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.