* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INEZIN |
| CAS: | 21722-85-0 |
| English Synonyms: | INEZIN |
| MDL Number.: | MFCD01705853 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCOP(=O)(c1ccccc1)SCc2ccccc2 |
| InChi: | InChI=1S/C15H17O2PS/c1-2-17-18(16,15-11-7-4-8-12-15)19-13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3 |
| InChiKey: | InChIKey=PBOOGLULPGUHFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.