* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ARSPHENAMINE |
| CAS: | 139-93-5 |
| English Synonyms: | ARSPHENAMINE |
| MDL Number.: | MFCD01707794 |
| H bond acceptor: | 4 |
| H bond donor: | 4 |
| Smile: | c1cc(c(cc1/[As]=[As]/c2ccc(c(c2)N)O)N)O.Cl.Cl |
| InChi: | InChI=1S/C12H12As2N2O2.2ClH/c15-9-5-7(1-3-11(9)17)13-14-8-2-4-12(18)10(16)6-8;;/h1-6,17-18H,15-16H2;2*1H |
| InChiKey: | InChIKey=VLAXZGHHBIJLAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.