* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOEGOMAKETONE |
| CAS: | 34348-59-9 |
| English Synonyms: | ISOEGOMAKETONE ; (2E)-1-(FURAN-3-YL)-4-METHYLPENT-2-EN-1-ONE |
| MDL Number.: | MFCD01709051 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)/C=C/C(=O)c1ccoc1 |
| InChi: | InChI=1S/C10H12O2/c1-8(2)3-4-10(11)9-5-6-12-7-9/h3-8H,1-2H3/b4-3+ |
| InChiKey: | InChIKey=XEYCZVQIOJGCNL-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.