* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JIETACIN A |
CAS: | 109766-61-2 |
English Synonyms: | JIETACIN A |
MDL Number.: | MFCD01709401 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(C)CCCCCC(=O)CCCCCCC/[N+](=N/C=C)/[O-] |
InChi: | InChI=1S/C18H34N2O2/c1-4-19-20(22)16-12-7-5-6-10-14-18(21)15-11-8-9-13-17(2)3/h4,17H,1,5-16H2,2-3H3/b20-19- |
InChiKey: | InChIKey=OZTRPFIXZNOEDA-VXPUYCOJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.