* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURAMIZOLE |
| CAS: | 17505-25-8 |
| English Synonyms: | FURAMIZOLE |
| MDL Number.: | MFCD01710633 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | c1cc(oc1)/C(=C\c2ccc(o2)[N+](=O)[O-])/c3nnc(o3)N |
| InChi: | InChI=1S/C12H8N4O5/c13-12-15-14-11(21-12)8(9-2-1-5-19-9)6-7-3-4-10(20-7)16(17)18/h1-6H,(H2,13,15)/b8-6+ |
| InChiKey: | InChIKey=YOWVEYCZVUOQAB-SOFGYWHQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.