* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYLENOMYCIN A |
| CAS: | 52775-76-5 |
| English Synonyms: | METHYLENOMYCIN A |
| MDL Number.: | MFCD01710766 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C[C@]12[C@@H](C(=C)C(=O)[C@]1(O2)C)C(=O)O |
| InChi: | InChI=1S/C9H10O4/c1-4-5(7(11)12)8(2)9(3,13-8)6(4)10/h5H,1H2,2-3H3,(H,11,12)/t5-,8-,9+/m0/s1 |
| InChiKey: | InChIKey=HBECYYFDLZZMPL-WLGLDCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.