* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-FLUOROOCTANOIC ACID |
| CAS: | 353-25-3 |
| English Synonyms: | 8-FLUOROOCTANOIC ACID |
| MDL Number.: | MFCD01711084 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C(CCCC(=O)O)CCCF |
| InChi: | InChI=1S/C8H15FO2/c9-7-5-3-1-2-4-6-8(10)11/h1-7H2,(H,10,11) |
| InChiKey: | InChIKey=SAEPUDOYZJDXEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.