* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LAUROTETANINE |
CAS: | 128-76-7 |
English Synonyms: | LAUROTETANINE |
MDL Number.: | MFCD01711527 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1cc2c3c(c1OC)-c4cc(c(cc4C[C@@H]3NCC2)O)OC |
InChi: | InChI=1S/C19H21NO4/c1-22-15-9-12-11(7-14(15)21)6-13-17-10(4-5-20-13)8-16(23-2)19(24-3)18(12)17/h7-9,13,20-21H,4-6H2,1-3H3/t13-/m0/s1 |
InChiKey: | InChIKey=GVVXPMORGFYVOO-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.