* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FEUDOMYCIN A |
CAS: | 79466-09-4 |
English Synonyms: | FEUDOMYCIN A |
MDL Number.: | MFCD01713147 |
H bond acceptor: | 10 |
H bond donor: | 5 |
Smile: | CC[C@@]1(Cc2c(c(c3c(c2O)C(=O)c4cccc(c4C3=O)OC)O)[C@H](C1)O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)N)O |
InChi: | InChI=1S/C27H31NO9/c1-4-27(34)9-13-19(16(10-27)37-17-8-14(28)22(29)11(2)36-17)26(33)21-20(24(13)31)23(30)12-6-5-7-15(35-3)18(12)25(21)32/h5-7,11,14,16-17,22,29,31,33-34H,4,8-10,28H2,1-3H3/t11-,14-,16-,17-,22+,27-/m0/s1 |
InChiKey: | InChIKey=XAMIMZAWZUSOPA-JIGXQNLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.