* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RAM-346 |
CAS: | 74924-35-9 |
English Synonyms: | RAM-346 |
MDL Number.: | MFCD01714340 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CN1CC[C@]23CC(=O)CC[C@H]2[C@H]1Cc4c3c(c(cc4)OC)OC |
InChi: | InChI=1S/C19H25NO3/c1-20-9-8-19-11-13(21)5-6-14(19)15(20)10-12-4-7-16(22-2)18(23-3)17(12)19/h4,7,14-15H,5-6,8-11H2,1-3H3/t14-,15+,19-/m0/s1 |
InChiKey: | InChIKey=YXHAMVMGQAWTHT-KHYOSLBOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.