* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC MALATE |
| CAS: | 2847-05-4 |
| English Synonyms: | ZINC MALATE |
| MDL Number.: | MFCD01716143 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C1C(C(=O)O[Zn]OC1=O)O |
| InChi: | InChI=1S/C4H6O5.Zn/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChiKey: | InChIKey=YMTJAFLYBRWKTF-UHFFFAOYSA-L |
|
|
| Comments: | 28.35% |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.