* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JUGLOMYCIN B |
CAS: | 38637-89-7 |
English Synonyms: | JUGLOMYCIN B |
MDL Number.: | MFCD01716651 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc2c(c(c1)O)C(=O)C=C(C2=O)[C@H]3[C@@H](CC(=O)O3)O |
InChi: | InChI=1S/C14H10O6/c15-8-3-1-2-6-12(8)9(16)4-7(13(6)19)14-10(17)5-11(18)20-14/h1-4,10,14-15,17H,5H2/t10-,14+/m1/s1 |
InChiKey: | InChIKey=JUTDGBUUAXODBT-YGRLFVJLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.