* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RETICULINE |
CAS: | 485-19-8 |
English Synonyms: | RETICULINE |
MDL Number.: | MFCD01716982 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CN1CCc2cc(c(cc2[C@@H]1Cc3ccc(c(c3)O)OC)O)OC |
InChi: | InChI=1S/C19H23NO4/c1-20-7-6-13-10-19(24-3)17(22)11-14(13)15(20)8-12-4-5-18(23-2)16(21)9-12/h4-5,9-11,15,21-22H,6-8H2,1-3H3/t15-/m0/s1 |
InChiKey: | InChIKey=BHLYRWXGMIUIHG-HNNXBMFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.