* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | REBECCAMYCIN |
CAS: | 93908-02-2 |
English Synonyms: | REBECCAMYCIN |
MDL Number.: | MFCD01718312 |
H bond acceptor: | 10 |
H bond donor: | 3 |
Smile: | CO[C@@H]1[C@H](O[C@H]([C@@H]([C@H]1O)O)C2CC3=C(C=C2Cl)N=c4c3c5c(=CN=C5Cl)c6c4N=C7C6=CC(=O)CC7=O)CO |
InChi: | InChI=1S/C27H21Cl2N3O7/c1-38-26-16(7-33)39-25(23(36)24(26)37)9-4-10-14(5-13(9)28)31-22-18(10)19-12(6-30-27(19)29)17-11-2-8(34)3-15(35)20(11)32-21(17)22/h2,5-6,9,16,23-26,33,36-37H,3-4,7H2,1H3/t9?,16-,23-,24-,25+,26-/m1/s1 |
InChiKey: | InChIKey=NXMSZCYHZLGGME-DNOUQMJISA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.