* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLE, 3-(2-AMINOPROPYL)-5-ETHOXY- |
CAS: | 101832-83-1 |
English Synonyms: | INDOLE, 3-(2-AMINOPROPYL)-5-ETHOXY- |
MDL Number.: | MFCD01719201 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCOc1ccc2c(c1)c(c[nH]2)CC(C)N |
InChi: | InChI=1S/C13H18N2O/c1-3-16-11-4-5-13-12(7-11)10(8-15-13)6-9(2)14/h4-5,7-9,15H,3,6,14H2,1-2H3 |
InChiKey: | InChIKey=RITFDCUITFOSHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.