* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDENESTROL B |
CAS: | 38028-27-2 |
English Synonyms: | INDENESTROL B |
MDL Number.: | MFCD01719567 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCC1c2ccc(cc2C(=C1c3ccc(cc3)O)C)O |
InChi: | InChI=1S/C18H18O2/c1-3-15-16-9-8-14(20)10-17(16)11(2)18(15)12-4-6-13(19)7-5-12/h4-10,15,19-20H,3H2,1-2H3 |
InChiKey: | InChIKey=HJVFIQKBLPQQDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.