* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YUEHCHUKENE |
| CAS: | 96624-37-2 |
| English Synonyms: | YUEHCHUKENE |
| MDL Number.: | MFCD01719607 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CC1=C[C@@H]2c3c4ccccc4[nH]c3[C@H]([C@@H]2C(C1)(C)C)c5c[nH]c6c5cccc6 |
| InChi: | InChI=1S/C26H26N2/c1-15-12-18-22-17-9-5-7-11-21(17)28-25(22)23(24(18)26(2,3)13-15)19-14-27-20-10-6-4-8-16(19)20/h4-12,14,18,23-24,27-28H,13H2,1-3H3/t18-,23+,24-/m1/s1 |
| InChiKey: | InChIKey=CZJCZWZKBWLSQX-PUZWTLIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.