* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHONAM NITRATE |
CAS: | 15037-55-5 |
English Synonyms: | ETHONAM NITRATE |
MDL Number.: | MFCD01721679 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1cncn1C2CCCc3c2cccc3.[N+](=O)(O)[O-] |
InChi: | InChI=1S/C16H18N2O2.HNO3/c1-2-20-16(19)15-10-17-11-18(15)14-9-5-7-12-6-3-4-8-13(12)14;2-1(3)4/h3-4,6,8,10-11,14H,2,5,7,9H2,1H3;(H,2,3,4) |
InChiKey: | InChIKey=UOEKCNNIZWEMHG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.