* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOCOFORMYCIN |
CAS: | 67187-35-3 |
English Synonyms: | ISOCOFORMYCIN |
MDL Number.: | MFCD01721954 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NC=NC(C2)O |
InChi: | InChI=1S/C11H16N4O5/c16-2-6-8(18)9(19)11(20-6)15-4-14-5-1-7(17)12-3-13-10(5)15/h3-4,6-9,11,16-19H,1-2H2,(H,12,13)/t6-,7?,8-,9-,11-/m1/s1 |
InChiKey: | InChIKey=KINKUHCNMYKMHT-VDZCSFMGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.