* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GONIODOMIN A |
| CAS: | 112923-40-7 |
| English Synonyms: | GONIODOMIN A |
| MDL Number.: | MFCD01723187 |
| H bond acceptor: | 12 |
| H bond donor: | 4 |
| Smile: | CC1CCOC(C1C)(C2/C=C/CC(C(C(=C)C3CCC(O3)C4C=CCC(O4)C5CCC(=C)C6(O5)CC(C(=C)C(O6)C7C(CC(=C)C(O7)C(=O)O2)O)C)O)O)O |
| InChi: | InChI=1S/C43H60O12/c1-22-18-19-49-43(48,28(22)7)36-13-8-10-29(44)37(46)27(6)31-16-17-34(50-31)32-11-9-12-33(51-32)35-15-14-25(4)42(54-35)21-24(3)26(5)39(55-42)40-30(45)20-23(2)38(53-40)41(47)52-36/h8-9,11,13,22,24,28-40,44-46,48H,2,4-6,10,12,14-21H2,1,3,7H3/b13-8+ |
| InChiKey: | InChIKey=UBLDAHNUOSMNHW-MDWZMJQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.