* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUANICAINE |
CAS: | 537-05-3 |
English Synonyms: | GUANICAINE |
MDL Number.: | MFCD01724110 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOc1ccc(cc1)N=C(Nc2ccc(cc2)OC)Nc3ccc(cc3)OC.Cl |
InChi: | InChI=1S/C23H25N3O3.ClH/c1-4-29-22-15-9-19(10-16-22)26-23(24-17-5-11-20(27-2)12-6-17)25-18-7-13-21(28-3)14-8-18;/h5-16H,4H2,1-3H3,(H2,24,25,26);1H |
InChiKey: | InChIKey=ZQWBGSZBBGYKNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.