* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GRISEOVIRIDIN |
| CAS: | 1393-90-4 |
| English Synonyms: | GRISEOVIRIDIN |
| MDL Number.: | MFCD01724491 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | C[C@@H]1C/C=C\2/C(=O)NC/C=C/C=C/[C@H](C[C@@H](Cc3nc(co3)C(=O)N[C@H](CS2)C(=O)O1)O)O |
| InChi: | InChI=1S/C22H27N3O7S/c1-13-6-7-18-21(29)23-8-4-2-3-5-14(26)9-15(27)10-19-24-16(11-31-19)20(28)25-17(12-33-18)22(30)32-13/h2-5,7,11,13-15,17,26-27H,6,8-10,12H2,1H3,(H,23,29)(H,25,28)/b4-2+,5-3+,18-7-/t13-,14-,15+,17-/m1/s1 |
| InChiKey: | InChIKey=UXWOXTQWVMFRSE-PUXWVVMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.