* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCOCYCLINE |
| CAS: | 751-98-4 |
| English Synonyms: | GLYCOCYCLINE |
| MDL Number.: | MFCD01724745 |
| H bond acceptor: | 13 |
| H bond donor: | 8 |
| Smile: | C[C@]1(c2cccc(c2C(=O)C3=C([C@]4([C@@H](C[C@@H]31)[C@@H](C(=C(C4=O)C(=O)NCNCC(=O)O)O)N(C)C)O)O)O)O |
| InChi: | InChI=1S/C25H29N3O10/c1-24(37)10-5-4-6-13(29)15(10)19(32)16-11(24)7-12-18(28(2)3)20(33)17(22(35)25(12,38)21(16)34)23(36)27-9-26-8-14(30)31/h4-6,11-12,18,26,29,33-34,37-38H,7-9H2,1-3H3,(H,27,36)(H,30,31)/t11-,12-,18-,24+,25-/m0/s1 |
| InChiKey: | InChIKey=ASQHOYTXXZGROZ-ZVKUQKJHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.