* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WU-385 |
CAS: | 19143-28-3 |
English Synonyms: | WU-385 |
MDL Number.: | MFCD01725132 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COC(=O)CCC(C(=O)N)N1C(=O)c2ccccc2C1=O |
InChi: | InChI=1S/C14H14N2O5/c1-21-11(17)7-6-10(12(15)18)16-13(19)8-4-2-3-5-9(8)14(16)20/h2-5,10H,6-7H2,1H3,(H2,15,18) |
InChiKey: | InChIKey=WVZKGMCPPYUQOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.