* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCOPIERICIDIN B |
| CAS: | 108073-61-6 |
| English Synonyms: | GLUCOPIERICIDIN B |
| MDL Number.: | MFCD01725346 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | C/C=C(\C)/[C@@H]([C@H](C)/C=C(\C)/C=C/C/C(=C/Cc1c(c(c(c(n1)OC)OC)OC2[C@H]([C@@H]([C@H]([C@@H](O2)CO)O)O)O)C)/C)O |
| InChi: | InChI=1S/C31H47NO9/c1-9-19(4)24(34)20(5)15-18(3)12-10-11-17(2)13-14-22-21(6)28(29(38-7)30(32-22)39-8)41-31-27(37)26(36)25(35)23(16-33)40-31/h9-10,12-13,15,20,23-27,31,33-37H,11,14,16H2,1-8H3/b12-10+,17-13+,18-15+,19-9+/t20-,23+,24+,25+,26-,27+,31?/m1/s1 |
| InChiKey: | InChIKey=WVZQNDRVLFQNNC-PBGBLAEASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.