* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZYLOFURAMINE |
| CAS: | 3563-92-6 |
| English Synonyms: | ZYLOFURAMINE |
| MDL Number.: | MFCD01725765 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCN[C@H](Cc1ccccc1)[C@H]2CCCO2 |
| InChi: | InChI=1S/C14H21NO/c1-2-15-13(14-9-6-10-16-14)11-12-7-4-3-5-8-12/h3-5,7-8,13-15H,2,6,9-11H2,1H3/t13-,14-/m1/s1 |
| InChiKey: | InChIKey=DOFCLOLKFGSRTG-ZIAGYGMSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.