* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WF 3681 |
CAS: | 105364-56-5 |
English Synonyms: | WF 3681 |
MDL Number.: | MFCD01725786 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C2=C(C(=O)OC2CCC(=O)O)O |
InChi: | InChI=1S/C13H12O5/c14-10(15)7-6-9-11(12(16)13(17)18-9)8-4-2-1-3-5-8/h1-5,9,16H,6-7H2,(H,14,15) |
InChiKey: | InChIKey=PPZVSYXNLXFYAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.