* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IVALIN |
CAS: | 5938-03-4 |
English Synonyms: | IVALIN |
MDL Number.: | MFCD01726763 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C[C@]12C[C@H](CC(=C)[C@@H]1C[C@H]3[C@@H](C2)OC(=O)C3=C)O |
InChi: | InChI=1S/C15H20O3/c1-8-4-10(16)6-15(3)7-13-11(5-12(8)15)9(2)14(17)18-13/h10-13,16H,1-2,4-7H2,3H3/t10-,11+,12-,13+,15+/m0/s1 |
InChiKey: | InChIKey=OVIILQQKQPCQTF-GGAZOKNXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.