* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WILFORGINE |
| CAS: | 37239-47-7 |
| English Synonyms: | WILFORGINE |
| MDL Number.: | MFCD01726769 |
| H bond acceptor: | 20 |
| H bond donor: | 1 |
| Smile: | C[C@H]1CCc2c(cccn2)C(=O)OC[C@]3([C@@H]4[C@H]([C@H]([C@@]5([C@H]([C@H]([C@@H]([C@]([C@]5(C4OC(=O)C)O3)(C)O)OC1=O)OC(=O)c6ccoc6)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
| InChi: | InChI=1S/C41H47NO19/c1-19-11-12-27-26(10-9-14-42-27)37(50)54-17-38(7)28-29(55-21(3)44)33(57-23(5)46)40(18-53-20(2)43)34(58-24(6)47)30(59-36(49)25-13-15-52-16-25)32(60-35(19)48)39(8,51)41(40,61-38)31(28)56-22(4)45/h9-10,13-16,19,28-34,51H,11-12,17-18H2,1-8H3/t19-,28+,29+,30-,31?,32-,33+,34-,38-,39-,40+,41-/m0/s1 |
| InChiKey: | InChIKey=QFIYSPKZWOALMZ-VESOVIEISA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.