Molecular Structure:
CCD No.:CCD00247347
OTAVA-BB 1149145
Formula:C13 H14 N2 O2
MolWeight:230.266
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1149145 |
| English Synonyms： | OTAVA-BB 1149145 |
| MDL Number.： | MFCD01727650 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | Cc1c(c(c([nH]1)c2ccc(cc2)O)N)C(=O)C |
| InChi： | InChI=1S/C13H14N2O2/c1-7-11(8(2)16)12(14)13(15-7)9-3-5-10(17)6-4-9/h3-6,15,17H,14H2,1-2H3 |
| InChiKey： | InChIKey=FAFLULXKPKCSPT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
