* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUADRONE |
| CAS: | 66550-08-1 |
| English Synonyms: | QUADRONE |
| MDL Number.: | MFCD01728137 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC1(CC23CC[C@@H]1[C@@H]4[C@@H]2[C@@H](COC3=O)C(=O)C4)C |
| InChi: | InChI=1S/C15H20O3/c1-14(2)7-15-4-3-10(14)8-5-11(16)9(12(8)15)6-18-13(15)17/h8-10,12H,3-7H2,1-2H3/t8-,9+,10-,12-,15?/m1/s1 |
| InChiKey: | InChIKey=IDBLOXXZDAIFNO-OVXTVLEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.