* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FUMIGACLAVINE A |
CAS: | 6879-59-0 |
English Synonyms: | FUMIGACLAVINE A |
MDL Number.: | MFCD01729203 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C[C@@H]1CN([C@@H]2Cc3c[nH]c4c3c(ccc4)[C@H]2[C@H]1OC(=O)C)C |
InChi: | InChI=1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15-,17-,18+/m1/s1 |
InChiKey: | InChIKey=GJSSYQDXZLZOLR-ONUGHKICSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.