* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ERGOLINE, 8-METHYL-6-(2-PROPENYL)-, (8-BETA)- |
| CAS: | 98931-10-3 |
| English Synonyms: | ERGOLINE, 8-METHYL-6-(2-PROPENYL)-, (8-BETA)- |
| MDL Number.: | MFCD01729227 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@@H]1C[C@@H]2c3cccc4c3c(c[nH]4)C[C@H]2N(C1)CC=C |
| InChi: | InChI=1S/C18H22N2/c1-3-7-20-11-12(2)8-15-14-5-4-6-16-18(14)13(10-19-16)9-17(15)20/h3-6,10,12,15,17,19H,1,7-9,11H2,2H3/t12-,15-,17-/m1/s1 |
| InChiKey: | InChIKey=VHNVZINWJUDCSU-SRCQZFHVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.